C13H14F9I — CID 88525691
(1Z)-5-iodo-5-methyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclooctene (PubChem CID 88525691) has the molecular formula C13H14F9I and a molecular weight of 468.14 g/mol. Its IUPAC name is (1Z)-5-iodo-5-methyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclooctene.
| Compound Name | (1Z)-5-iodo-5-methyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclooctene |
|---|---|
| PubChem CID | 88525691 |
| Molecular Formula | C13H14F9I |
| Molecular Weight | 468.14 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | (1Z)-5-iodo-5-methyl-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)cyclooctene |
| SMILES | CC1(I)CCC/C=C\CC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H14F9I/c1-9(23)7-5-3-2-4-6-8(9)10(14,15)11(16,17)12(18,19)13(20,21)22/h2,4,8H,3,5-7H2,1H3/b4-2- |
| InChIKey | DQXIXUTVXCRCLT-RQOWECAXSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.14 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|