About mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate)
mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate) (PubChem CID 88526149) has the molecular formula C12H24HgN6S4
and a molecular weight of 581.22 g/mol. Its IUPAC name is mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate).
Molecular Properties
| Compound Name | mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate) |
| PubChem CID | 88526149 |
| Molecular Formula | C12H24HgN6S4 |
| Molecular Weight | 581.22 g/mol |
| Exact Mass | 582.07 |
| IUPAC Name | mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate) |
| SMILES | CN(C(=S)[S-])N1CCNCC1.CN(C(=S)[S-])N1CCNCC1.[Hg+2] |
| InChI | InChI=1S/2C6H13N3S2.Hg/c2*1-8(6(10)11)9-4-2-7-3-5-9;/h2*7H,2-5H2,1H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | YTBJUJISGOMXBL-UHFFFAOYSA-L |
| XLogP | -0.86 |
| TPSA | 37.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 581.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate)?
The IUPAC name of mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate) (CID 88526149) is mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate).
What is the SMILES notation for mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate)?
The canonical SMILES for mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate) is CN(C(=S)[S-])N1CCNCC1.CN(C(=S)[S-])N1CCNCC1.[Hg+2].
What is the InChIKey of mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate)?
The InChIKey is YTBJUJISGOMXBL-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H13N3S2.Hg/c2*1-8(6(10)11)9-4-2-7-3-5-9;/h2*7H,2-5H2,1H3,(H,10,11);/q;;+2/p-2.
What are the key properties of mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate)?
mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate) has a molecular weight of 581.22 g/mol, XLogP of -0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for mercury(2+);bis(N-methyl-N-piperazin-1-ylcarbamodithioate) is sourced from PubChem (CID 88526149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).