About 6-fluoro-8H-indeno[1,2-b]thiophene
6-fluoro-8H-indeno[1,2-b]thiophene (PubChem CID 88526497) has the molecular formula C11H7FS
and a molecular weight of 190.24 g/mol. Its IUPAC name is 6-fluoro-8H-indeno[1,2-b]thiophene.
Molecular Properties
| Compound Name | 6-fluoro-8H-indeno[1,2-b]thiophene |
| PubChem CID | 88526497 |
| Molecular Formula | C11H7FS |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 6-fluoro-8H-indeno[1,2-b]thiophene |
| SMILES | FC1=CCC2=c3sccc3=CC2=C1 |
| InChI | InChI=1S/C11H7FS/c12-9-1-2-10-8(6-9)5-7-3-4-13-11(7)10/h1,3-6H,2H2 |
| InChIKey | PGWIUFFKPXCLJN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-8H-indeno[1,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-8H-indeno[1,2-b]thiophene?
The IUPAC name of 6-fluoro-8H-indeno[1,2-b]thiophene (CID 88526497) is 6-fluoro-8H-indeno[1,2-b]thiophene.
What is the SMILES notation for 6-fluoro-8H-indeno[1,2-b]thiophene?
The canonical SMILES for 6-fluoro-8H-indeno[1,2-b]thiophene is FC1=CCC2=c3sccc3=CC2=C1.
What is the InChIKey of 6-fluoro-8H-indeno[1,2-b]thiophene?
The InChIKey is PGWIUFFKPXCLJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7FS/c12-9-1-2-10-8(6-9)5-7-3-4-13-11(7)10/h1,3-6H,2H2.
What are the key properties of 6-fluoro-8H-indeno[1,2-b]thiophene?
6-fluoro-8H-indeno[1,2-b]thiophene has a molecular weight of 190.24 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-8H-indeno[1,2-b]thiophene is sourced from PubChem (CID 88526497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).