About 1-(dimethylamino)ethyl carbamate;isocyanic acid
1-(dimethylamino)ethyl carbamate;isocyanic acid (PubChem CID 88526700) has the molecular formula C6H13N3O3
and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl carbamate;isocyanic acid.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl carbamate;isocyanic acid |
| PubChem CID | 88526700 |
| Molecular Formula | C6H13N3O3 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1-(dimethylamino)ethyl carbamate;isocyanic acid |
| SMILES | CC(OC(N)=O)N(C)C.N=C=O |
| InChI | InChI=1S/C5H12N2O2.CHNO/c1-4(7(2)3)9-5(6)8;2-1-3/h4H,1-3H3,(H2,6,8);2H |
| InChIKey | PKCQHXHYVOXAAO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl carbamate;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl carbamate;isocyanic acid?
The IUPAC name of 1-(dimethylamino)ethyl carbamate;isocyanic acid (CID 88526700) is 1-(dimethylamino)ethyl carbamate;isocyanic acid.
What is the SMILES notation for 1-(dimethylamino)ethyl carbamate;isocyanic acid?
The canonical SMILES for 1-(dimethylamino)ethyl carbamate;isocyanic acid is CC(OC(N)=O)N(C)C.N=C=O.
What is the InChIKey of 1-(dimethylamino)ethyl carbamate;isocyanic acid?
The InChIKey is PKCQHXHYVOXAAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2.CHNO/c1-4(7(2)3)9-5(6)8;2-1-3/h4H,1-3H3,(H2,6,8);2H.
What are the key properties of 1-(dimethylamino)ethyl carbamate;isocyanic acid?
1-(dimethylamino)ethyl carbamate;isocyanic acid has a molecular weight of 175.19 g/mol, XLogP of -0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl carbamate;isocyanic acid is sourced from PubChem (CID 88526700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).