C24H32OZr — CID 88526747
acetaldehyde;ethylidenezirconium(2+);1-[1-(4,5,6,7-tetrahydro-1H-inden-1-yl)ethyl]-4,5,6,7-tetrahydro-1H-indene (PubChem CID 88526747) has the molecular formula C24H32OZr and a molecular weight of 427.74 g/mol. Its IUPAC name is acetaldehyde;ethylidenezirconium(2+);1-[1-(4,5,6,7-tetrahydro-1H-inden-1-yl)ethyl]-4,5,6,7-tetrahydro-1H-indene.
| Compound Name | acetaldehyde;ethylidenezirconium(2+);1-[1-(4,5,6,7-tetrahydro-1H-inden-1-yl)ethyl]-4,5,6,7-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 88526747 |
| Molecular Formula | C24H32OZr |
| Molecular Weight | 427.74 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | acetaldehyde;ethylidenezirconium(2+);1-[1-(4,5,6,7-tetrahydro-1H-inden-1-yl)ethyl]-4,5,6,7-tetrahydro-1H-indene |
| SMILES | CC=[Zr+2].[CH2-]C(C1C=CC2=C1CCCC2)C1C=CC2=C1CCCC2.[CH2-]C=O |
| InChI | InChI=1S/C20H25.C2H3O.C2H4.Zr/c1-14(17-12-10-15-6-2-4-8-19(15)17)18-13-11-16-7-3-5-9-20(16)18;1-2-3;1-2;/h10-14,17-18H,1-9H2;2H,1H2;1H,2H3;/q2*-1;;+2 |
| InChIKey | DYQDUTSYBOKEIT-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.74 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|