About N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide
N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide (PubChem CID 8852706) has the molecular formula C22H20N2O3
and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide.
Molecular Properties
| Compound Name | N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide |
| PubChem CID | 8852706 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide |
| SMILES | Cc1noc(C)c1CCC(=O)Nc1ccc(-c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C22H20N2O3/c1-14-19(15(2)27-24-14)11-12-22(25)23-18-9-7-16(8-10-18)21-13-17-5-3-4-6-20(17)26-21/h3-10,13H,11-12H2,1-2H3,(H,23,25) |
| InChIKey | FANZBSMKUKMQRP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide?
The IUPAC name of N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide (CID 8852706) is N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide.
What is the SMILES notation for N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide?
The canonical SMILES for N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide is Cc1noc(C)c1CCC(=O)Nc1ccc(-c2cc3ccccc3o2)cc1.
What is the InChIKey of N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide?
The InChIKey is FANZBSMKUKMQRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O3/c1-14-19(15(2)27-24-14)11-12-22(25)23-18-9-7-16(8-10-18)21-13-17-5-3-4-6-20(17)26-21/h3-10,13H,11-12H2,1-2H3,(H,23,25).
What are the key properties of N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide?
N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide has a molecular weight of 360.41 g/mol, XLogP of 5.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1-benzofuran-2-yl)phenyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)propanamide is sourced from PubChem (CID 8852706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).