C28H37NO7S2 — CID 88527213
(2R)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[3-[(2S)-2-(1-methoxy-2-phenylethenyl)-4-oxoazetidin-1-yl]dithian-3-yl]acetaldehyde (PubChem CID 88527213) has the molecular formula C28H37NO7S2 and a molecular weight of 563.74 g/mol. Its IUPAC name is (2R)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[3-[(2S)-2-(1-methoxy-2-phenylethenyl)-4-oxoazetidin-1-yl]dithian-3-yl]acetaldehyde.
| Compound Name | (2R)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[3-[(2S)-2-(1-methoxy-2-phenylethenyl)-4-oxoazetidin-1-yl]dithian-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 88527213 |
| Molecular Formula | C28H37NO7S2 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | (2R)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[3-[(2S)-2-(1-methoxy-2-phenylethenyl)-4-oxoazetidin-1-yl]dithian-3-yl]acetaldehyde |
| SMILES | COC(=Cc1ccccc1)[C@@H]1CC(=O)N1C1([C@@H](C=O)[C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)CCCSS1 |
| InChI | InChI=1S/C28H37NO7S2/c1-26(2)33-17-22(34-26)25-24(35-27(3,4)36-25)19(16-30)28(12-9-13-37-38-28)29-20(15-23(29)31)21(32-5)14-18-10-7-6-8-11-18/h6-8,10-11,14,16,19-20,22,24-25H,9,12-13,15,17H2,1-5H3/t19-,20-,22+,24+,25+,28?/m0/s1 |
| InChIKey | LXBNKDJFOAJLOQ-PYUFELGKSA-N |
| XLogP | 4.63 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|