About 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine
2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine (PubChem CID 88527320) has the molecular formula C13H18N2O3
and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine |
| PubChem CID | 88527320 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H4O3.C5H14N2/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-7(2)5-3-4-6/h1-4H;3-6H2,1-2H3 |
| InChIKey | JCJSQMRLGRONRY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine?
The IUPAC name of 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine (CID 88527320) is 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine.
What is the SMILES notation for 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine?
The canonical SMILES for 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine is CN(C)CCCN.O=C1OC(=O)c2ccccc21.
What is the InChIKey of 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine?
The InChIKey is JCJSQMRLGRONRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4O3.C5H14N2/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-7(2)5-3-4-6/h1-4H;3-6H2,1-2H3.
What are the key properties of 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine?
2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine has a molecular weight of 250.30 g/mol, XLogP of 0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzofuran-1,3-dione;N',N'-dimethylpropane-1,3-diamine is sourced from PubChem (CID 88527320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).