C24H22N4O2S2 — CID 88528300
2-[4-[[2-(2,2-dimethylpropyl)-4,7-bis(sulfanylidene)imidazo[4,5-d]pyridazin-3-yl]methyl]phenyl]benzoic acid (PubChem CID 88528300) has the molecular formula C24H22N4O2S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 2-[4-[[2-(2,2-dimethylpropyl)-4,7-bis(sulfanylidene)imidazo[4,5-d]pyridazin-3-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-(2,2-dimethylpropyl)-4,7-bis(sulfanylidene)imidazo[4,5-d]pyridazin-3-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 88528300 |
| Molecular Formula | C24H22N4O2S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 2-[4-[[2-(2,2-dimethylpropyl)-4,7-bis(sulfanylidene)imidazo[4,5-d]pyridazin-3-yl]methyl]phenyl]benzoic acid |
| SMILES | CC(C)(C)Cc1nc2c(n1Cc1ccc(-c3ccccc3C(=O)O)cc1)C(=S)N=NC2=S |
| InChI | InChI=1S/C24H22N4O2S2/c1-24(2,3)12-18-25-19-20(22(32)27-26-21(19)31)28(18)13-14-8-10-15(11-9-14)16-6-4-5-7-17(16)23(29)30/h4-11H,12-13H2,1-3H3,(H,29,30) |
| InChIKey | HCPKZJLFUFMSQJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|