C15H20N2O — CID 88528345
N-[1-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-3-phenylpropylidene]hydroxylamine (PubChem CID 88528345) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-[1-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-3-phenylpropylidene]hydroxylamine.
| Compound Name | N-[1-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-3-phenylpropylidene]hydroxylamine |
|---|---|
| PubChem CID | 88528345 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-[1-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-3-phenylpropylidene]hydroxylamine |
| SMILES | CC1NCCC=C1C(CCc1ccccc1)=NO |
| InChI | InChI=1S/C15H20N2O/c1-12-14(8-5-11-16-12)15(17-18)10-9-13-6-3-2-4-7-13/h2-4,6-8,12,16,18H,5,9-11H2,1H3 |
| InChIKey | UUSIXJLDGDXKSC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|