About 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine
2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine (PubChem CID 88528514) has the molecular formula C10H14ClN3O
and a molecular weight of 227.69 g/mol. Its IUPAC name is 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine.
Molecular Properties
| Compound Name | 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine |
| PubChem CID | 88528514 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine |
| SMILES | CC1NCCOC1(C)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C10H14ClN3O/c1-7-10(2,15-6-5-12-7)8-3-4-9(11)14-13-8/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | YXYQRMDDVCJJCT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine?
The IUPAC name of 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine (CID 88528514) is 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine.
What is the SMILES notation for 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine?
The canonical SMILES for 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine is CC1NCCOC1(C)c1ccc(Cl)nn1.
What is the InChIKey of 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine?
The InChIKey is YXYQRMDDVCJJCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3O/c1-7-10(2,15-6-5-12-7)8-3-4-9(11)14-13-8/h3-4,7,12H,5-6H2,1-2H3.
What are the key properties of 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine?
2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine has a molecular weight of 227.69 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloropyridazin-3-yl)-2,3-dimethylmorpholine is sourced from PubChem (CID 88528514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).