About 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene
1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene (PubChem CID 88529010) has the molecular formula C9H6Cl3F3O
and a molecular weight of 293.50 g/mol. Its IUPAC name is 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene.
Molecular Properties
| Compound Name | 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene |
| PubChem CID | 88529010 |
| Molecular Formula | C9H6Cl3F3O |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene |
| SMILES | FCC(F)(F)Oc1ccccc1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H6Cl3F3O/c10-9(11,12)6-3-1-2-4-7(6)16-8(14,15)5-13/h1-4H,5H2 |
| InChIKey | SQXATHLCXQGGJB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene?
The IUPAC name of 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene (CID 88529010) is 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene.
What is the SMILES notation for 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene?
The canonical SMILES for 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene is FCC(F)(F)Oc1ccccc1C(Cl)(Cl)Cl.
What is the InChIKey of 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene?
The InChIKey is SQXATHLCXQGGJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Cl3F3O/c10-9(11,12)6-3-1-2-4-7(6)16-8(14,15)5-13/h1-4H,5H2.
What are the key properties of 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene?
1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene has a molecular weight of 293.50 g/mol, XLogP of 4.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(trichloromethyl)-2-(1,1,2-trifluoroethoxy)benzene is sourced from PubChem (CID 88529010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).