C22H17ClN2O2 — CID 8852910
N-[(R)-(4-chlorophenyl)-phenylmethyl]-2-(3-cyanophenoxy)acetamide (PubChem CID 8852910) has the molecular formula C22H17ClN2O2 and a molecular weight of 376.84 g/mol. Its IUPAC name is N-[(R)-(4-chlorophenyl)-phenylmethyl]-2-(3-cyanophenoxy)acetamide.
| Compound Name | N-[(R)-(4-chlorophenyl)-phenylmethyl]-2-(3-cyanophenoxy)acetamide |
|---|---|
| PubChem CID | 8852910 |
| Molecular Formula | C22H17ClN2O2 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-[(R)-(4-chlorophenyl)-phenylmethyl]-2-(3-cyanophenoxy)acetamide |
| SMILES | N#Cc1cccc(OCC(=O)N[C@H](c2ccccc2)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H17ClN2O2/c23-19-11-9-18(10-12-19)22(17-6-2-1-3-7-17)25-21(26)15-27-20-8-4-5-16(13-20)14-24/h1-13,22H,15H2,(H,25,26)/t22-/m1/s1 |
| InChIKey | RUILIAUXHILZNU-JOCHJYFZSA-N |
| XLogP | 4.50 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |