C21H32OS — CID 88529215
1-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenyl]sulfanylpropan-2-one (PubChem CID 88529215) has the molecular formula C21H32OS and a molecular weight of 332.55 g/mol. Its IUPAC name is 1-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenyl]sulfanylpropan-2-one.
| Compound Name | 1-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenyl]sulfanylpropan-2-one |
|---|---|
| PubChem CID | 88529215 |
| Molecular Formula | C21H32OS |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenyl]sulfanylpropan-2-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCSCC(C)=O |
| InChI | InChI=1S/C21H32OS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-20-21(2)22/h4-5,7-8,10-11,13-14,16-17H,3,6,9,12,15,18-20H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | XQNGHSXIKXKAGP-JEBPEJKESA-N |
| XLogP | 6.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|