C40H19F8N3 — CID 88529249
9-[3-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-1,2,3,4,5,6,7,8-octafluorocarbazole (PubChem CID 88529249) has the molecular formula C40H19F8N3 and a molecular weight of 693.60 g/mol. Its IUPAC name is 9-[3-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-1,2,3,4,5,6,7,8-octafluorocarbazole.
| Compound Name | 9-[3-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-1,2,3,4,5,6,7,8-octafluorocarbazole |
|---|---|
| PubChem CID | 88529249 |
| Molecular Formula | C40H19F8N3 |
| Molecular Weight | 693.60 g/mol |
| Exact Mass | 693.15 |
| IUPAC Name | 9-[3-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]phenyl]-1,2,3,4,5,6,7,8-octafluorocarbazole |
| SMILES | Fc1c(F)c(F)c2c(c1F)c1c(F)c(F)c(F)c(F)c1n2-c1cccc(-c2cccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C40H19F8N3/c41-30-28-29-31(42)33(44)35(46)37(48)39(29)51(38(28)36(47)34(45)32(30)43)25-16-8-14-23(18-25)22-13-7-15-24(17-22)27-19-26(20-9-3-1-4-10-20)49-40(50-27)21-11-5-2-6-12-21/h1-19H |
| InChIKey | PKWSSWREPRHNGC-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.60 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|