C8H6F8N2 — CID 88529376
1,5-dimethyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole (PubChem CID 88529376) has the molecular formula C8H6F8N2 and a molecular weight of 282.13 g/mol. Its IUPAC name is 1,5-dimethyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole.
| Compound Name | 1,5-dimethyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 88529376 |
| Molecular Formula | C8H6F8N2 |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 1,5-dimethyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole |
| SMILES | Cc1c(C(F)(F)F)c(C(F)(F)C(F)(F)F)nn1C |
| InChI | InChI=1S/C8H6F8N2/c1-3-4(7(11,12)13)5(17-18(3)2)6(9,10)8(14,15)16/h1-2H3 |
| InChIKey | NUIXZHJCXXXUDB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|