C12H18F6O — CID 88529426
(Z)-5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)non-7-en-2-ol (PubChem CID 88529426) has the molecular formula C12H18F6O and a molecular weight of 292.26 g/mol. Its IUPAC name is (Z)-5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)non-7-en-2-ol.
| Compound Name | (Z)-5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)non-7-en-2-ol |
|---|---|
| PubChem CID | 88529426 |
| Molecular Formula | C12H18F6O |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (Z)-5-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)non-7-en-2-ol |
| SMILES | C/C=C\CC(CC)CCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H18F6O/c1-3-5-6-9(4-2)7-8-10(19,11(13,14)15)12(16,17)18/h3,5,9,19H,4,6-8H2,1-2H3/b5-3- |
| InChIKey | POLRGDZBAOKFGU-HYXAFXHYSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|