C32H39N3O5 — CID 88529440
(1R,9R,10S,14R)-17-(cyclopropylmethyl)-3,4,10-trihydroxy-14-methyl-13-N-phenyl-12-N-propan-2-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene-12,13-dicarboxamide (PubChem CID 88529440) has the molecular formula C32H39N3O5 and a molecular weight of 545.68 g/mol. Its IUPAC name is (1R,9R,10S,14R)-17-(cyclopropylmethyl)-3,4,10-trihydroxy-14-methyl-13-N-phenyl-12-N-propan-2-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene-12,13-dicarboxamide.
| Compound Name | (1R,9R,10S,14R)-17-(cyclopropylmethyl)-3,4,10-trihydroxy-14-methyl-13-N-phenyl-12-N-propan-2-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene-12,13-dicarboxamide |
|---|---|
| PubChem CID | 88529440 |
| Molecular Formula | C32H39N3O5 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | (1R,9R,10S,14R)-17-(cyclopropylmethyl)-3,4,10-trihydroxy-14-methyl-13-N-phenyl-12-N-propan-2-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,12-tetraene-12,13-dicarboxamide |
| SMILES | CC(C)NC(=O)C1=C(C(=O)Nc2ccccc2)[C@H](C)[C@]23CCN(CC4CC4)[C@H](Cc4ccc(O)c(O)c42)[C@]3(O)C1 |
| InChI | InChI=1S/C32H39N3O5/c1-18(2)33-29(38)23-16-32(40)25-15-21-11-12-24(36)28(37)27(21)31(32,13-14-35(25)17-20-9-10-20)19(3)26(23)30(39)34-22-7-5-4-6-8-22/h4-8,11-12,18-20,25,36-37,40H,9-10,13-17H2,1-3H3,(H,33,38)(H,34,39)/t19-,25+,31+,32+/m0/s1 |
| InChIKey | DSAPKWOCZSTGTI-RQOZHSSOSA-N |
| XLogP | 3.61 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|