About (2E)-4-methoxypenta-2,4-dien-2-amine
(2E)-4-methoxypenta-2,4-dien-2-amine (PubChem CID 88529526) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is (2E)-4-methoxypenta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2E)-4-methoxypenta-2,4-dien-2-amine |
| PubChem CID | 88529526 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (2E)-4-methoxypenta-2,4-dien-2-amine |
| SMILES | C=C(/C=C(\C)N)OC |
| InChI | InChI=1S/C6H11NO/c1-5(7)4-6(2)8-3/h4H,2,7H2,1,3H3/b5-4+ |
| InChIKey | LNFJEMPBFZGVEF-SNAWJCMRSA-N |
| XLogP | 1.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-methoxypenta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-methoxypenta-2,4-dien-2-amine?
The IUPAC name of (2E)-4-methoxypenta-2,4-dien-2-amine (CID 88529526) is (2E)-4-methoxypenta-2,4-dien-2-amine.
What is the SMILES notation for (2E)-4-methoxypenta-2,4-dien-2-amine?
The canonical SMILES for (2E)-4-methoxypenta-2,4-dien-2-amine is C=C(/C=C(\C)N)OC.
What is the InChIKey of (2E)-4-methoxypenta-2,4-dien-2-amine?
The InChIKey is LNFJEMPBFZGVEF-SNAWJCMRSA-N. The full InChI is InChI=1S/C6H11NO/c1-5(7)4-6(2)8-3/h4H,2,7H2,1,3H3/b5-4+.
What are the key properties of (2E)-4-methoxypenta-2,4-dien-2-amine?
(2E)-4-methoxypenta-2,4-dien-2-amine has a molecular weight of 113.16 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-methoxypenta-2,4-dien-2-amine is sourced from PubChem (CID 88529526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).