C27H38N6O3 — CID 88529632
2-[4-[[(1-ethyl-3a,7a-dihydroindol-3-yl)methylamino]methyl]piperidin-1-yl]-N-(oxan-2-yloxy)pyrimidine-5-carboxamide (PubChem CID 88529632) has the molecular formula C27H38N6O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is 2-[4-[[(1-ethyl-3a,7a-dihydroindol-3-yl)methylamino]methyl]piperidin-1-yl]-N-(oxan-2-yloxy)pyrimidine-5-carboxamide.
| Compound Name | 2-[4-[[(1-ethyl-3a,7a-dihydroindol-3-yl)methylamino]methyl]piperidin-1-yl]-N-(oxan-2-yloxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 88529632 |
| Molecular Formula | C27H38N6O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | 2-[4-[[(1-ethyl-3a,7a-dihydroindol-3-yl)methylamino]methyl]piperidin-1-yl]-N-(oxan-2-yloxy)pyrimidine-5-carboxamide |
| SMILES | CCN1C=C(CNCC2CCN(c3ncc(C(=O)NOC4CCCCO4)cn3)CC2)C2C=CC=CC21 |
| InChI | InChI=1S/C27H38N6O3/c1-2-32-19-22(23-7-3-4-8-24(23)32)16-28-15-20-10-12-33(13-11-20)27-29-17-21(18-30-27)26(34)31-36-25-9-5-6-14-35-25/h3-4,7-8,17-20,23-25,28H,2,5-6,9-16H2,1H3,(H,31,34) |
| InChIKey | VZVKRQAHUIOCQD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|