C35H44N2 — CID 88529999
(E)-5-[4-[4-(1,2,5,6,7,8-hexahydronaphthalen-2-yl)-1,7,8,8a-tetrahydronaphthalen-1-yl]cyclohexyl]-3-(2H-pyrrol-3-yl)pent-4-en-1-imine (PubChem CID 88529999) has the molecular formula C35H44N2 and a molecular weight of 492.75 g/mol. Its IUPAC name is (E)-5-[4-[4-(1,2,5,6,7,8-hexahydronaphthalen-2-yl)-1,7,8,8a-tetrahydronaphthalen-1-yl]cyclohexyl]-3-(2H-pyrrol-3-yl)pent-4-en-1-imine.
| Compound Name | (E)-5-[4-[4-(1,2,5,6,7,8-hexahydronaphthalen-2-yl)-1,7,8,8a-tetrahydronaphthalen-1-yl]cyclohexyl]-3-(2H-pyrrol-3-yl)pent-4-en-1-imine |
|---|---|
| PubChem CID | 88529999 |
| Molecular Formula | C35H44N2 |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | (E)-5-[4-[4-(1,2,5,6,7,8-hexahydronaphthalen-2-yl)-1,7,8,8a-tetrahydronaphthalen-1-yl]cyclohexyl]-3-(2H-pyrrol-3-yl)pent-4-en-1-imine |
| SMILES | [H]/N=C/CC(/C=C/C1CCC(C2C=CC(C3C=CC4=C(CCCC4)C3)=C3C=CCCC32)CC1)C1=CC=NC1 |
| InChI | InChI=1S/C35H44N2/c36-21-19-27(31-20-22-37-24-31)12-9-25-10-13-28(14-11-25)32-17-18-33(35-8-4-3-7-34(32)35)30-16-15-26-5-1-2-6-29(26)23-30/h4,8-9,12,15-18,20-22,25,27-28,30,32,34,36H,1-3,5-7,10-11,13-14,19,23-24H2/b12-9+,36-21+ |
| InChIKey | WLEJPILYPCXFKG-BOZDVOTOSA-N |
| XLogP | 8.91 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|