C48H59N — CID 88530010
N-[(Z)-2-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-5-[4-(4-oct-1-en-3-ylcyclohexa-2,4-dien-1-yl)-2,3,4,4a-tetrahydronaphthalen-1-yl]hex-2-enyl]aniline (PubChem CID 88530010) has the molecular formula C48H59N and a molecular weight of 650.01 g/mol. Its IUPAC name is N-[(Z)-2-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-5-[4-(4-oct-1-en-3-ylcyclohexa-2,4-dien-1-yl)-2,3,4,4a-tetrahydronaphthalen-1-yl]hex-2-enyl]aniline.
| Compound Name | N-[(Z)-2-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-5-[4-(4-oct-1-en-3-ylcyclohexa-2,4-dien-1-yl)-2,3,4,4a-tetrahydronaphthalen-1-yl]hex-2-enyl]aniline |
|---|---|
| PubChem CID | 88530010 |
| Molecular Formula | C48H59N |
| Molecular Weight | 650.01 g/mol |
| Exact Mass | 649.46 |
| IUPAC Name | N-[(Z)-2-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-5-[4-(4-oct-1-en-3-ylcyclohexa-2,4-dien-1-yl)-2,3,4,4a-tetrahydronaphthalen-1-yl]hex-2-enyl]aniline |
| SMILES | C=CC(CCCCC)C1=CCC(C2CCC(C(C)C/C=C(\CNc3ccccc3)C3=CC=C(C4=CC=CCC4)CC3)=C3C=CC=CC32)C=C1 |
| InChI | InChI=1S/C48H59N/c1-4-6-9-16-37(5-2)39-29-31-42(32-30-39)46-34-33-45(47-21-14-15-22-48(46)47)36(3)23-24-43(35-49-44-19-12-8-13-20-44)41-27-25-40(26-28-41)38-17-10-7-11-18-38/h5,7-8,10,12-15,17,19-22,24-25,27,29-31,36-37,42,46,48-49H,2,4,6,9,11,16,18,23,26,28,32-35H2,1,3H3/b43-24+ |
| InChIKey | FUQZBQIAHYLOED-RWOOANICSA-N |
| XLogP | 13.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.01 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|