C36H55N — CID 88530026
(2Z,6E)-6-ethyl-2-[4-(4-heptan-3-ylcyclohex-3-en-1-yl)-1,2,3,8a-tetrahydronaphthalen-1-yl]undeca-2,6-dien-1-imine (PubChem CID 88530026) has the molecular formula C36H55N and a molecular weight of 501.84 g/mol. Its IUPAC name is (2Z,6E)-6-ethyl-2-[4-(4-heptan-3-ylcyclohex-3-en-1-yl)-1,2,3,8a-tetrahydronaphthalen-1-yl]undeca-2,6-dien-1-imine.
| Compound Name | (2Z,6E)-6-ethyl-2-[4-(4-heptan-3-ylcyclohex-3-en-1-yl)-1,2,3,8a-tetrahydronaphthalen-1-yl]undeca-2,6-dien-1-imine |
|---|---|
| PubChem CID | 88530026 |
| Molecular Formula | C36H55N |
| Molecular Weight | 501.84 g/mol |
| Exact Mass | 501.43 |
| IUPAC Name | (2Z,6E)-6-ethyl-2-[4-(4-heptan-3-ylcyclohex-3-en-1-yl)-1,2,3,8a-tetrahydronaphthalen-1-yl]undeca-2,6-dien-1-imine |
| SMILES | [H]/N=C/C(=C\CC/C(=C/CCCC)CC)C1CCC(C2CC=C(C(CC)CCCC)CC2)=C2C=CC=CC21 |
| InChI | InChI=1S/C36H55N/c1-5-9-11-15-28(7-3)16-14-18-32(27-37)34-26-25-33(35-19-12-13-20-36(34)35)31-23-21-30(22-24-31)29(8-4)17-10-6-2/h12-13,15,18-21,27,29,31,34,36-37H,5-11,14,16-17,22-26H2,1-4H3/b28-15+,32-18+,37-27+ |
| InChIKey | BKBIMDAMJMMXRE-RRHDTESRSA-N |
| XLogP | 11.26 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.84 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|