C34H37N — CID 88530027
2-[4-[4-[(Z)-5-(2,3-dihydronaphthalen-2-yl)hex-3-en-2-yl]cyclohexa-1,3-dien-1-yl]-2,3-dihydronaphthalen-1-yl]ethanimine (PubChem CID 88530027) has the molecular formula C34H37N and a molecular weight of 459.68 g/mol. Its IUPAC name is 2-[4-[4-[(Z)-5-(2,3-dihydronaphthalen-2-yl)hex-3-en-2-yl]cyclohexa-1,3-dien-1-yl]-2,3-dihydronaphthalen-1-yl]ethanimine.
| Compound Name | 2-[4-[4-[(Z)-5-(2,3-dihydronaphthalen-2-yl)hex-3-en-2-yl]cyclohexa-1,3-dien-1-yl]-2,3-dihydronaphthalen-1-yl]ethanimine |
|---|---|
| PubChem CID | 88530027 |
| Molecular Formula | C34H37N |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 2-[4-[4-[(Z)-5-(2,3-dihydronaphthalen-2-yl)hex-3-en-2-yl]cyclohexa-1,3-dien-1-yl]-2,3-dihydronaphthalen-1-yl]ethanimine |
| SMILES | [H]/N=C/CC1=c2ccccc2=C(C2=CC=C(C(C)/C=C\C(C)C3C=c4ccccc4=CC3)CC2)CC1 |
| InChI | InChI=1S/C34H37N/c1-24(11-12-25(2)30-18-15-27-7-3-4-8-31(27)23-30)26-13-16-28(17-14-26)33-20-19-29(21-22-35)32-9-5-6-10-34(32)33/h3-13,15-16,22-25,30,35H,14,17-21H2,1-2H3/b12-11-,35-22+ |
| InChIKey | DVYOVDXGLVWZSH-OOJQLMCSSA-N |
| XLogP | 5.58 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|