C41H39N — CID 88530043
(2Z,4E)-5-[4-[4-[4-(2,3,7,8-tetrahydronaphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,3-dihydronaphthalen-1-yl]-2,3-dihydronaphthalen-1-yl]penta-2,4-dien-1-imine (PubChem CID 88530043) has the molecular formula C41H39N and a molecular weight of 545.77 g/mol. Its IUPAC name is (2Z,4E)-5-[4-[4-[4-(2,3,7,8-tetrahydronaphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,3-dihydronaphthalen-1-yl]-2,3-dihydronaphthalen-1-yl]penta-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-5-[4-[4-[4-(2,3,7,8-tetrahydronaphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,3-dihydronaphthalen-1-yl]-2,3-dihydronaphthalen-1-yl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 88530043 |
| Molecular Formula | C41H39N |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | (2Z,4E)-5-[4-[4-[4-(2,3,7,8-tetrahydronaphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,3-dihydronaphthalen-1-yl]-2,3-dihydronaphthalen-1-yl]penta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C\C=C\C1=c2ccccc2=C(C2=c3ccccc3=C(C3=CC=C(C4C=C5CCC=CC5=CC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C41H39N/c42-27-9-1-2-11-31-23-24-40(37-14-6-5-13-35(31)37)41-26-25-36(38-15-7-8-16-39(38)41)32-20-17-30(18-21-32)34-22-19-29-10-3-4-12-33(29)28-34/h1-3,5-11,13-17,19-20,27-28,34,42H,4,12,18,21-26H2/b9-1-,11-2+,42-27+ |
| InChIKey | PFYGIAQKMNIPEO-ZUCYXWGVSA-N |
| XLogP | 7.21 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|