C42H51N — CID 88530073
(E)-3-[2-[4-[4-[4-(2,3-dihydronaphthalen-1-yl)cyclohex-2-en-1-yl]-2,3,7,8-tetrahydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]ethyl]-4-methylhept-4-en-1-imine (PubChem CID 88530073) has the molecular formula C42H51N and a molecular weight of 569.88 g/mol. Its IUPAC name is (E)-3-[2-[4-[4-[4-(2,3-dihydronaphthalen-1-yl)cyclohex-2-en-1-yl]-2,3,7,8-tetrahydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]ethyl]-4-methylhept-4-en-1-imine.
| Compound Name | (E)-3-[2-[4-[4-[4-(2,3-dihydronaphthalen-1-yl)cyclohex-2-en-1-yl]-2,3,7,8-tetrahydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]ethyl]-4-methylhept-4-en-1-imine |
|---|---|
| PubChem CID | 88530073 |
| Molecular Formula | C42H51N |
| Molecular Weight | 569.88 g/mol |
| Exact Mass | 569.40 |
| IUPAC Name | (E)-3-[2-[4-[4-[4-(2,3-dihydronaphthalen-1-yl)cyclohex-2-en-1-yl]-2,3,7,8-tetrahydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]ethyl]-4-methylhept-4-en-1-imine |
| SMILES | [H]/N=C/CC(CCC1=CC=C(C2=C3CCC=CC3=C(C3C=CC(C4=c5ccccc5=CCC4)CC3)CC2)CC1)/C(C)=C/CC |
| InChI | InChI=1S/C42H51N/c1-3-9-30(2)32(28-29-43)19-16-31-17-20-34(21-18-31)39-26-27-40(42-14-7-6-13-41(39)42)36-24-22-35(23-25-36)38-15-8-11-33-10-4-5-12-37(33)38/h4-5,7,9-12,14,17,20,22,24,29,32,35-36,43H,3,6,8,13,15-16,18-19,21,23,25-28H2,1-2H3/b30-9+,43-29+ |
| InChIKey | VHMYKRSLCGPLFC-BTISBNPUSA-N |
| XLogP | 10.17 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.88 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|