C32H40N2 — CID 88530085
(2Z)-2-[(E)-3-[4-(4-cyclohexa-1,3-dien-1-ylcyclohex-2-en-1-yl)-1,2,3,8a-tetrahydronaphthalen-1-yl]prop-2-enylidene]heptane-1,7-diimine (PubChem CID 88530085) has the molecular formula C32H40N2 and a molecular weight of 452.69 g/mol. Its IUPAC name is (2Z)-2-[(E)-3-[4-(4-cyclohexa-1,3-dien-1-ylcyclohex-2-en-1-yl)-1,2,3,8a-tetrahydronaphthalen-1-yl]prop-2-enylidene]heptane-1,7-diimine.
| Compound Name | (2Z)-2-[(E)-3-[4-(4-cyclohexa-1,3-dien-1-ylcyclohex-2-en-1-yl)-1,2,3,8a-tetrahydronaphthalen-1-yl]prop-2-enylidene]heptane-1,7-diimine |
|---|---|
| PubChem CID | 88530085 |
| Molecular Formula | C32H40N2 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | (2Z)-2-[(E)-3-[4-(4-cyclohexa-1,3-dien-1-ylcyclohex-2-en-1-yl)-1,2,3,8a-tetrahydronaphthalen-1-yl]prop-2-enylidene]heptane-1,7-diimine |
| SMILES | [H]/N=C/CCCCC(=C/C=C/C1CCC(C2C=CC(C3=CC=CCC3)CC2)=C2C=CC=CC21)/C=N/[H] |
| InChI | InChI=1S/C32H40N2/c33-23-8-2-3-10-25(24-34)11-9-14-28-21-22-31(32-16-7-6-15-30(28)32)29-19-17-27(18-20-29)26-12-4-1-5-13-26/h1,4,6-7,9,11-12,14-17,19,23-24,27-30,33-34H,2-3,5,8,10,13,18,20-22H2/b14-9+,25-11-,33-23+,34-24+ |
| InChIKey | RLRUCIOZKXUTLH-AHZLDYNJSA-N |
| XLogP | 8.64 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|