C36H45N — CID 88530097
3-[(5S)-5-[4-[4-(3,4,4a,7,8,8a-hexahydronaphthalen-2-yl)-2,3,4,4a,5,6-hexahydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]cyclohexen-1-yl]-3,4-dihydro-2H-pyrrole (PubChem CID 88530097) has the molecular formula C36H45N and a molecular weight of 491.76 g/mol. Its IUPAC name is 3-[(5S)-5-[4-[4-(3,4,4a,7,8,8a-hexahydronaphthalen-2-yl)-2,3,4,4a,5,6-hexahydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]cyclohexen-1-yl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 3-[(5S)-5-[4-[4-(3,4,4a,7,8,8a-hexahydronaphthalen-2-yl)-2,3,4,4a,5,6-hexahydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]cyclohexen-1-yl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 88530097 |
| Molecular Formula | C36H45N |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 491.36 |
| IUPAC Name | 3-[(5S)-5-[4-[4-(3,4,4a,7,8,8a-hexahydronaphthalen-2-yl)-2,3,4,4a,5,6-hexahydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]cyclohexen-1-yl]-3,4-dihydro-2H-pyrrole |
| SMILES | C1=CC2CCC(C3CCC(C4=CC=C([C@H]5CCC=C(C6CC=NC6)C5)CC4)=C4C=CCCC43)=CC2CC1 |
| InChI | InChI=1S/C36H45N/c1-2-7-28-23-31(17-14-25(28)6-1)34-19-18-33(35-10-3-4-11-36(34)35)27-15-12-26(13-16-27)29-8-5-9-30(22-29)32-20-21-37-24-32/h1,3,6,9-10,12,15,21,23,25,28-29,32,34,36H,2,4-5,7-8,11,13-14,16-20,22,24H2/t25?,28?,29-,32?,34?,36?/m0/s1 |
| InChIKey | AQMVVMFVWXOBPG-DFGZYLIZSA-N |
| XLogP | 9.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|