C42H53N — CID 88530098
4-[(4S)-4-[4-[4-(6-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)-2,3,5,6-tetrahydronaphthalen-1-yl]cyclohex-3-en-1-yl]-1,2,3,4,5,6,7,8-octahydronaphthalen-1-yl]-3,4-dihydro-2H-pyrrole (PubChem CID 88530098) has the molecular formula C42H53N and a molecular weight of 571.89 g/mol. Its IUPAC name is 4-[(4S)-4-[4-[4-(6-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)-2,3,5,6-tetrahydronaphthalen-1-yl]cyclohex-3-en-1-yl]-1,2,3,4,5,6,7,8-octahydronaphthalen-1-yl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 4-[(4S)-4-[4-[4-(6-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)-2,3,5,6-tetrahydronaphthalen-1-yl]cyclohex-3-en-1-yl]-1,2,3,4,5,6,7,8-octahydronaphthalen-1-yl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 88530098 |
| Molecular Formula | C42H53N |
| Molecular Weight | 571.89 g/mol |
| Exact Mass | 571.42 |
| IUPAC Name | 4-[(4S)-4-[4-[4-(6-cyclohex-3-en-1-ylcyclohexa-1,3-dien-1-yl)-2,3,5,6-tetrahydronaphthalen-1-yl]cyclohex-3-en-1-yl]-1,2,3,4,5,6,7,8-octahydronaphthalen-1-yl]-3,4-dihydro-2H-pyrrole |
| SMILES | C1=CCC(C2CC=CCC2)C(C2=C3CCC=CC3=C(C3=CCC([C@@H]4CCC(C5C=NCC5)C5=C4CCCC5)CC3)CC2)=C1 |
| InChI | InChI=1S/C42H53N/c1-2-10-29(11-3-1)33-12-4-5-13-37(33)42-25-24-35(39-15-8-9-17-41(39)42)31-20-18-30(19-21-31)34-22-23-36(32-26-27-43-28-32)40-16-7-6-14-38(34)40/h1-2,4-5,8,13,15,20,28-30,32-34,36H,3,6-7,9-12,14,16-19,21-27H2/t29?,30?,32?,33?,34-,36?/m0/s1 |
| InChIKey | CZOPFRBXVVVYGC-FSCYUSIQSA-N |
| XLogP | 11.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.89 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|