C45H58N2 — CID 88530231
(2S)-2-[(4aE,12Z)-12-(1,2,3,4,4b,8a-hexahydrophenanthren-9-yl)-10-[(2Z)-1-cyclohexylpenta-2,4-dienyl]-5-methyl-2,9,9a,11-tetrahydro-1H-benzo[d][1]benzazocin-8-yl]butan-1-amine (PubChem CID 88530231) has the molecular formula C45H58N2 and a molecular weight of 626.97 g/mol. Its IUPAC name is (2S)-2-[(4aE,12Z)-12-(1,2,3,4,4b,8a-hexahydrophenanthren-9-yl)-10-[(2Z)-1-cyclohexylpenta-2,4-dienyl]-5-methyl-2,9,9a,11-tetrahydro-1H-benzo[d][1]benzazocin-8-yl]butan-1-amine.
| Compound Name | (2S)-2-[(4aE,12Z)-12-(1,2,3,4,4b,8a-hexahydrophenanthren-9-yl)-10-[(2Z)-1-cyclohexylpenta-2,4-dienyl]-5-methyl-2,9,9a,11-tetrahydro-1H-benzo[d][1]benzazocin-8-yl]butan-1-amine |
|---|---|
| PubChem CID | 88530231 |
| Molecular Formula | C45H58N2 |
| Molecular Weight | 626.97 g/mol |
| Exact Mass | 626.46 |
| IUPAC Name | (2S)-2-[(4aE,12Z)-12-(1,2,3,4,4b,8a-hexahydrophenanthren-9-yl)-10-[(2Z)-1-cyclohexylpenta-2,4-dienyl]-5-methyl-2,9,9a,11-tetrahydro-1H-benzo[d][1]benzazocin-8-yl]butan-1-amine |
| SMILES | C=C/C=C\C(C1CCCCC1)N1C/C(C2=CC3=C(CCCC3)C3C=CC=CC23)=C2/CCC=C/C2=C(\C)C2=CC=C([C@H](CC)CN)CC21 |
| InChI | InChI=1S/C45H58N2/c1-4-6-24-44(33-16-8-7-9-17-33)47-30-43(42-27-35-18-10-11-20-38(35)40-22-14-15-23-41(40)42)39-21-13-12-19-36(39)31(3)37-26-25-34(28-45(37)47)32(5-2)29-46/h4,6,12,14-15,19,22-27,32-33,40-41,44-45H,1,5,7-11,13,16-18,20-21,28-30,46H2,2-3H3/b24-6-,36-31-,43-39+/t32-,40?,41?,44?,45?/m1/s1 |
| InChIKey | SBNUAQQRAOIVLM-GBFCYUCESA-N |
| XLogP | 10.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.97 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|