C35H52N2 — CID 88530241
N-[(E)-5-(4-cyclohex-3-en-1-yl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl)-2-(1-iminobutan-2-yl)hex-4-enyl]-2-propylcyclohexa-1,3-dien-1-amine (PubChem CID 88530241) has the molecular formula C35H52N2 and a molecular weight of 500.82 g/mol. Its IUPAC name is N-[(E)-5-(4-cyclohex-3-en-1-yl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl)-2-(1-iminobutan-2-yl)hex-4-enyl]-2-propylcyclohexa-1,3-dien-1-amine.
| Compound Name | N-[(E)-5-(4-cyclohex-3-en-1-yl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl)-2-(1-iminobutan-2-yl)hex-4-enyl]-2-propylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 88530241 |
| Molecular Formula | C35H52N2 |
| Molecular Weight | 500.82 g/mol |
| Exact Mass | 500.41 |
| IUPAC Name | N-[(E)-5-(4-cyclohex-3-en-1-yl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl)-2-(1-iminobutan-2-yl)hex-4-enyl]-2-propylcyclohexa-1,3-dien-1-amine |
| SMILES | [H]/N=C/C(CC)C(C/C=C(\C)C1CCC(C2CC=CCC2)=C2C=CCCC21)CNC1=C(CCC)C=CCC1 |
| InChI | InChI=1S/C35H52N2/c1-4-13-29-16-9-12-19-35(29)37-25-30(27(5-2)24-36)21-20-26(3)31-22-23-32(28-14-7-6-8-15-28)34-18-11-10-17-33(31)34/h6-7,9,11,16,18,20,24,27-28,30-31,33,36-37H,4-5,8,10,12-15,17,19,21-23,25H2,1-3H3/b26-20+,36-24+ |
| InChIKey | UXWPFIAJVHPUKO-AQNVYEAFSA-N |
| XLogP | 9.64 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.82 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|