About (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one
(5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one (PubChem CID 88530264) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one |
| PubChem CID | 88530264 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one |
| SMILES | C=C/C=C\C=C1/CNC(=C)NC1=O |
| InChI | InChI=1S/C10H12N2O/c1-3-4-5-6-9-7-11-8(2)12-10(9)13/h3-6,11H,1-2,7H2,(H,12,13)/b5-4-,9-6+ |
| InChIKey | HQWOAGLSUFXICX-KMOPYBJPSA-N |
| XLogP | 0.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one?
The IUPAC name of (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one (CID 88530264) is (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one.
What is the SMILES notation for (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one?
The canonical SMILES for (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one is C=C/C=C\C=C1/CNC(=C)NC1=O.
What is the InChIKey of (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one?
The InChIKey is HQWOAGLSUFXICX-KMOPYBJPSA-N. The full InChI is InChI=1S/C10H12N2O/c1-3-4-5-6-9-7-11-8(2)12-10(9)13/h3-6,11H,1-2,7H2,(H,12,13)/b5-4-,9-6+.
What are the key properties of (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one?
(5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one has a molecular weight of 176.22 g/mol, XLogP of 0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-2-methylidene-5-[(2Z)-penta-2,4-dienylidene]-1,3-diazinan-4-one is sourced from PubChem (CID 88530264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).