C24H33NO3S — CID 88530316
cis-(2S,4R)-3-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-2-[3-(5-formylthiophen-2-yl)propyl]-4-hydroxycyclopentane-1-carbonitrile (PubChem CID 88530316) has the molecular formula C24H33NO3S and a molecular weight of 415.60 g/mol. Its IUPAC name is cis-(2S,4R)-3-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-2-[3-(5-formylthiophen-2-yl)propyl]-4-hydroxycyclopentane-1-carbonitrile.
| Compound Name | cis-(2S,4R)-3-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-2-[3-(5-formylthiophen-2-yl)propyl]-4-hydroxycyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 88530316 |
| Molecular Formula | C24H33NO3S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | cis-(2S,4R)-3-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-2-[3-(5-formylthiophen-2-yl)propyl]-4-hydroxycyclopentane-1-carbonitrile |
| SMILES | CCC1(C(O)C/C=C/C2[C@@H](CCCc3ccc(C=O)s3)C(C#N)C[C@H]2O)CCC1 |
| InChI | InChI=1S/C24H33NO3S/c1-2-24(12-5-13-24)23(28)9-4-8-21-20(17(15-25)14-22(21)27)7-3-6-18-10-11-19(16-26)29-18/h4,8,10-11,16-17,20-23,27-28H,2-3,5-7,9,12-14H2,1H3/b8-4+/t17?,20-,21?,22+,23?/m0/s1 |
| InChIKey | JRMYVICWXLEHSL-UMQLEBQQSA-N |
| XLogP | 4.91 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|