C30H59N3O12 — CID 88530469
N-[[4-[2,2-bis[[3-hydroxy-4-[(propanoylamino)methoxy]butoxy]methyl]butoxy]-2-hydroxybutoxy]methyl]propanamide (PubChem CID 88530469) has the molecular formula C30H59N3O12 and a molecular weight of 653.81 g/mol. Its IUPAC name is N-[[4-[2,2-bis[[3-hydroxy-4-[(propanoylamino)methoxy]butoxy]methyl]butoxy]-2-hydroxybutoxy]methyl]propanamide.
| Compound Name | N-[[4-[2,2-bis[[3-hydroxy-4-[(propanoylamino)methoxy]butoxy]methyl]butoxy]-2-hydroxybutoxy]methyl]propanamide |
|---|---|
| PubChem CID | 88530469 |
| Molecular Formula | C30H59N3O12 |
| Molecular Weight | 653.81 g/mol |
| Exact Mass | 653.41 |
| IUPAC Name | N-[[4-[2,2-bis[[3-hydroxy-4-[(propanoylamino)methoxy]butoxy]methyl]butoxy]-2-hydroxybutoxy]methyl]propanamide |
| SMILES | CCC(=O)NCOCC(O)CCOCC(CC)(COCCC(O)COCNC(=O)CC)COCCC(O)COCNC(=O)CC |
| InChI | InChI=1S/C30H59N3O12/c1-5-27(37)31-21-43-15-24(34)9-12-40-18-30(8-4,19-41-13-10-25(35)16-44-22-32-28(38)6-2)20-42-14-11-26(36)17-45-23-33-29(39)7-3/h24-26,34-36H,5-23H2,1-4H3,(H,31,37)(H,32,38)(H,33,39) |
| InChIKey | OFFMETXJUQSQQF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 203.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.81 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|