About N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide
N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide (PubChem CID 88530643) has the molecular formula C12H20N2O6
and a molecular weight of 288.30 g/mol. Its IUPAC name is N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide |
| PubChem CID | 88530643 |
| Molecular Formula | C12H20N2O6 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCOCC(O)C(O)COCNC(=O)C=C |
| InChI | InChI=1S/C12H20N2O6/c1-3-11(17)13-7-19-5-9(15)10(16)6-20-8-14-12(18)4-2/h3-4,9-10,15-16H,1-2,5-8H2,(H,13,17)(H,14,18) |
| InChIKey | UQBKHBLYXQVZOL-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide?
The IUPAC name of N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide (CID 88530643) is N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide.
What is the SMILES notation for N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide?
The canonical SMILES for N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide is C=CC(=O)NCOCC(O)C(O)COCNC(=O)C=C.
What is the InChIKey of N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide?
The InChIKey is UQBKHBLYXQVZOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O6/c1-3-11(17)13-7-19-5-9(15)10(16)6-20-8-14-12(18)4-2/h3-4,9-10,15-16H,1-2,5-8H2,(H,13,17)(H,14,18).
What are the key properties of N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide?
N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide has a molecular weight of 288.30 g/mol, XLogP of -1.74, 11 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2,3-dihydroxy-4-[(prop-2-enoylamino)methoxy]butoxy]methyl]prop-2-enamide is sourced from PubChem (CID 88530643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).