About 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine
1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine (PubChem CID 88530658) has the molecular formula C9H15F6NO5S2
and a molecular weight of 395.34 g/mol. Its IUPAC name is 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine.
Molecular Properties
| Compound Name | 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine |
| PubChem CID | 88530658 |
| Molecular Formula | C9H15F6NO5S2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine |
| SMILES | CCCOCC(N)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H15F6NO5S2/c1-2-3-21-5-6(16)4-7(22(17,18)8(10,11)12)23(19,20)9(13,14)15/h6-7H,2-5,16H2,1H3 |
| InChIKey | KYGWSYWLVTYXJS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine?
The IUPAC name of 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine (CID 88530658) is 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine.
What is the SMILES notation for 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine?
The canonical SMILES for 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine is CCCOCC(N)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.
What is the InChIKey of 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine?
The InChIKey is KYGWSYWLVTYXJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F6NO5S2/c1-2-3-21-5-6(16)4-7(22(17,18)8(10,11)12)23(19,20)9(13,14)15/h6-7H,2-5,16H2,1H3.
What are the key properties of 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine?
1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine has a molecular weight of 395.34 g/mol, XLogP of 1.33, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propoxy-4,4-bis(trifluoromethylsulfonyl)butan-2-amine is sourced from PubChem (CID 88530658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).