C18H28BrN2O9P — CID 88530712
[[(E)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enyl]-(3-ethoxypropoxy)phosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 88530712) has the molecular formula C18H28BrN2O9P and a molecular weight of 527.31 g/mol. Its IUPAC name is [[(E)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enyl]-(3-ethoxypropoxy)phosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [[(E)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enyl]-(3-ethoxypropoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 88530712 |
| Molecular Formula | C18H28BrN2O9P |
| Molecular Weight | 527.31 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | [[(E)-4-(5-bromo-2,4-dioxopyrimidin-1-yl)but-2-enyl]-(3-ethoxypropoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | CCOCCCOP(=O)(C/C=C/Cn1cc(Br)c(=O)[nH]c1=O)OCOC(=O)OC(C)C |
| InChI | InChI=1S/C18H28BrN2O9P/c1-4-26-9-7-10-28-31(25,29-13-27-18(24)30-14(2)3)11-6-5-8-21-12-15(19)16(22)20-17(21)23/h5-6,12,14H,4,7-11,13H2,1-3H3,(H,20,22,23)/b6-5+ |
| InChIKey | CGDLGSLFMVOTAL-AATRIKPKSA-N |
| XLogP | 3.03 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|