C15H17F8NO — CID 88531183
4-(2-ethoxy-1,1,1,3,3,4,4,4-octafluorobutan-2-yl)-2-ethyl-6-methylaniline (PubChem CID 88531183) has the molecular formula C15H17F8NO and a molecular weight of 379.29 g/mol. Its IUPAC name is 4-(2-ethoxy-1,1,1,3,3,4,4,4-octafluorobutan-2-yl)-2-ethyl-6-methylaniline.
| Compound Name | 4-(2-ethoxy-1,1,1,3,3,4,4,4-octafluorobutan-2-yl)-2-ethyl-6-methylaniline |
|---|---|
| PubChem CID | 88531183 |
| Molecular Formula | C15H17F8NO |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-(2-ethoxy-1,1,1,3,3,4,4,4-octafluorobutan-2-yl)-2-ethyl-6-methylaniline |
| SMILES | CCOC(c1cc(C)c(N)c(CC)c1)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H17F8NO/c1-4-9-7-10(6-8(3)11(9)24)12(25-5-2,14(18,19)20)13(16,17)15(21,22)23/h6-7H,4-5,24H2,1-3H3 |
| InChIKey | TUOMMKUHCLGGRM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|