C10H7BrF7N — CID 88531199
2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylaniline (PubChem CID 88531199) has the molecular formula C10H7BrF7N and a molecular weight of 354.06 g/mol. Its IUPAC name is 2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylaniline.
| Compound Name | 2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylaniline |
|---|---|
| PubChem CID | 88531199 |
| Molecular Formula | C10H7BrF7N |
| Molecular Weight | 354.06 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylaniline |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(Br)c1N |
| InChI | InChI=1S/C10H7BrF7N/c1-4-2-5(3-6(11)7(4)19)8(12,9(13,14)15)10(16,17)18/h2-3H,19H2,1H3 |
| InChIKey | PLSVLVAJUFTDOY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.06 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|