C22H28F3N3O6 — CID 88531348
cyclopentyl 1-[[6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]methylamino]cyclopentane-1-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 88531348) has the molecular formula C22H28F3N3O6 and a molecular weight of 487.48 g/mol. Its IUPAC name is cyclopentyl 1-[[6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]methylamino]cyclopentane-1-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | cyclopentyl 1-[[6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]methylamino]cyclopentane-1-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 88531348 |
| Molecular Formula | C22H28F3N3O6 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | cyclopentyl 1-[[6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]methylamino]cyclopentane-1-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(/C=C/c1ccc(CNC2(C(=O)OC3CCCC3)CCCC2)cn1)NO.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H27N3O4.C2HF3O2/c24-18(23-26)10-9-16-8-7-15(13-21-16)14-22-20(11-3-4-12-20)19(25)27-17-5-1-2-6-17;3-2(4,5)1(6)7/h7-10,13,17,22,26H,1-6,11-12,14H2,(H,23,24);(H,6,7)/b10-9+; |
| InChIKey | PPJNLTGSNDJXGO-RRABGKBLSA-N |
| XLogP | 3.12 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|