C22H26F3N3O5 — CID 88531349
cyclopentyl 1-[[6-[(E)-3-oxo-3-[(2,2,2-trifluoroacetyl)oxyamino]prop-1-enyl]-3-pyridinyl]methylamino]cyclopentane-1-carboxylate (PubChem CID 88531349) has the molecular formula C22H26F3N3O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is cyclopentyl 1-[[6-[(E)-3-oxo-3-[(2,2,2-trifluoroacetyl)oxyamino]prop-1-enyl]-3-pyridinyl]methylamino]cyclopentane-1-carboxylate.
| Compound Name | cyclopentyl 1-[[6-[(E)-3-oxo-3-[(2,2,2-trifluoroacetyl)oxyamino]prop-1-enyl]-3-pyridinyl]methylamino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 88531349 |
| Molecular Formula | C22H26F3N3O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | cyclopentyl 1-[[6-[(E)-3-oxo-3-[(2,2,2-trifluoroacetyl)oxyamino]prop-1-enyl]-3-pyridinyl]methylamino]cyclopentane-1-carboxylate |
| SMILES | O=C(/C=C/c1ccc(CNC2(C(=O)OC3CCCC3)CCCC2)cn1)NOC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H26F3N3O5/c23-22(24,25)20(31)33-28-18(29)10-9-16-8-7-15(13-26-16)14-27-21(11-3-4-12-21)19(30)32-17-5-1-2-6-17/h7-10,13,17,27H,1-6,11-12,14H2,(H,28,29)/b10-9+ |
| InChIKey | ZVYNOBZOIXIAER-MDZDMXLPSA-N |
| XLogP | 3.12 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|