C21H28F3N3O6 — CID 88531481
(3-methylcyclopentyl) 2-[[6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]methylamino]-2-methylpropanoate;2,2,2-trifluoroacetic acid (PubChem CID 88531481) has the molecular formula C21H28F3N3O6 and a molecular weight of 475.46 g/mol. Its IUPAC name is (3-methylcyclopentyl) 2-[[6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]methylamino]-2-methylpropanoate;2,2,2-trifluoroacetic acid.
| Compound Name | (3-methylcyclopentyl) 2-[[6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]methylamino]-2-methylpropanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 88531481 |
| Molecular Formula | C21H28F3N3O6 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (3-methylcyclopentyl) 2-[[6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]methylamino]-2-methylpropanoate;2,2,2-trifluoroacetic acid |
| SMILES | CC1CCC(OC(=O)C(C)(C)NCc2ccc(/C=C/C(=O)NO)nc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H27N3O4.C2HF3O2/c1-13-4-8-16(10-13)26-18(24)19(2,3)21-12-14-5-6-15(20-11-14)7-9-17(23)22-25;3-2(4,5)1(6)7/h5-7,9,11,13,16,21,25H,4,8,10,12H2,1-3H3,(H,22,23);(H,6,7)/b9-7+; |
| InChIKey | IBBBDQBSGVZSGV-BXTVWIJMSA-N |
| XLogP | 2.83 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|