C28H41NO3Si — CID 88531552
tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,3,4,4-pentadeuterio-5-methylpiperidine-1-carboxylate (PubChem CID 88531552) has the molecular formula C28H41NO3Si and a molecular weight of 472.76 g/mol. Its IUPAC name is tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,3,4,4-pentadeuterio-5-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,3,4,4-pentadeuterio-5-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 88531552 |
| Molecular Formula | C28H41NO3Si |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | tert-butyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3,3,4,4-pentadeuterio-5-methylpiperidine-1-carboxylate |
| SMILES | [2H]C1([2H])[C@H](C)CN(C(=O)OC(C)(C)C)[C@]([2H])(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C28H41NO3Si/c1-22-18-19-23(29(20-22)26(30)32-27(2,3)4)21-31-33(28(5,6)7,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-17,22-23H,18-21H2,1-7H3/t22-,23-/m0/s1/i18D2,19D2,23D |
| InChIKey | GMHWMHQGUIWKPP-AGHGNIQNSA-N |
| XLogP | 5.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|