About 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid
5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid (PubChem CID 88531708) has the molecular formula C13H17F2N3O2
and a molecular weight of 285.29 g/mol. Its IUPAC name is 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid.
Molecular Properties
| Compound Name | 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid |
| PubChem CID | 88531708 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid |
| SMILES | CNc1c(N)cc(C(=O)O)c(N2CCC(F)(F)C2)c1C |
| InChI | InChI=1S/C13H17F2N3O2/c1-7-10(17-2)9(16)5-8(12(19)20)11(7)18-4-3-13(14,15)6-18/h5,17H,3-4,6,16H2,1-2H3,(H,19,20) |
| InChIKey | ZYFSUWNOKBSCHP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid?
The IUPAC name of 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid (CID 88531708) is 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid.
What is the SMILES notation for 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid?
The canonical SMILES for 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid is CNc1c(N)cc(C(=O)O)c(N2CCC(F)(F)C2)c1C.
What is the InChIKey of 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid?
The InChIKey is ZYFSUWNOKBSCHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2N3O2/c1-7-10(17-2)9(16)5-8(12(19)20)11(7)18-4-3-13(14,15)6-18/h5,17H,3-4,6,16H2,1-2H3,(H,19,20).
What are the key properties of 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid?
5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid has a molecular weight of 285.29 g/mol, XLogP of 2.16, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(3,3-difluoropyrrolidin-1-yl)-3-methyl-4-(methylamino)benzoic acid is sourced from PubChem (CID 88531708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).