C24H15Cl4NO2Si — CID 88531776
2,3,4,5-tetrachloro-6-triphenylsilyloxyiminocyclohexa-2,4-dien-1-one (PubChem CID 88531776) has the molecular formula C24H15Cl4NO2Si and a molecular weight of 519.29 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-triphenylsilyloxyiminocyclohexa-2,4-dien-1-one.
| Compound Name | 2,3,4,5-tetrachloro-6-triphenylsilyloxyiminocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 88531776 |
| Molecular Formula | C24H15Cl4NO2Si |
| Molecular Weight | 519.29 g/mol |
| Exact Mass | 516.96 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-triphenylsilyloxyiminocyclohexa-2,4-dien-1-one |
| SMILES | O=C1C(=NO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)C(Cl)=C(Cl)C(Cl)=C1Cl |
| InChI | InChI=1S/C24H15Cl4NO2Si/c25-19-20(26)22(28)24(30)23(21(19)27)29-31-32(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | AHNFIYPZQFCBEU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|