About (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one
(2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one (PubChem CID 88532060) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one.
Molecular Properties
| Compound Name | (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one |
| PubChem CID | 88532060 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one |
| SMILES | CO/N=C1/CCCC(=O)/C1=N\OC |
| InChI | InChI=1S/C8H12N2O3/c1-12-9-6-4-3-5-7(11)8(6)10-13-2/h3-5H2,1-2H3/b9-6-,10-8- |
| InChIKey | YIJYGIPAKVLUHK-PTKGMRGESA-N |
| XLogP | 0.74 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one?
The IUPAC name of (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one (CID 88532060) is (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one.
What is the SMILES notation for (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one?
The canonical SMILES for (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one is CO/N=C1/CCCC(=O)/C1=N\OC.
What is the InChIKey of (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one?
The InChIKey is YIJYGIPAKVLUHK-PTKGMRGESA-N. The full InChI is InChI=1S/C8H12N2O3/c1-12-9-6-4-3-5-7(11)8(6)10-13-2/h3-5H2,1-2H3/b9-6-,10-8-.
What are the key properties of (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one?
(2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one has a molecular weight of 184.19 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,3Z)-2,3-bis(methoxyimino)cyclohexan-1-one is sourced from PubChem (CID 88532060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).