About N-oxo-1,2-dihydroquinoline-3-carboxamide
N-oxo-1,2-dihydroquinoline-3-carboxamide (PubChem CID 88532555) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is N-oxo-1,2-dihydroquinoline-3-carboxamide.
Molecular Properties
| Compound Name | N-oxo-1,2-dihydroquinoline-3-carboxamide |
| PubChem CID | 88532555 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | N-oxo-1,2-dihydroquinoline-3-carboxamide |
| SMILES | O=NC(=O)C1=Cc2ccccc2NC1 |
| InChI | InChI=1S/C10H8N2O2/c13-10(12-14)8-5-7-3-1-2-4-9(7)11-6-8/h1-5,11H,6H2 |
| InChIKey | GFAGHCPSFAXPDV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-oxo-1,2-dihydroquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oxo-1,2-dihydroquinoline-3-carboxamide?
The IUPAC name of N-oxo-1,2-dihydroquinoline-3-carboxamide (CID 88532555) is N-oxo-1,2-dihydroquinoline-3-carboxamide.
What is the SMILES notation for N-oxo-1,2-dihydroquinoline-3-carboxamide?
The canonical SMILES for N-oxo-1,2-dihydroquinoline-3-carboxamide is O=NC(=O)C1=Cc2ccccc2NC1.
What is the InChIKey of N-oxo-1,2-dihydroquinoline-3-carboxamide?
The InChIKey is GFAGHCPSFAXPDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c13-10(12-14)8-5-7-3-1-2-4-9(7)11-6-8/h1-5,11H,6H2.
What are the key properties of N-oxo-1,2-dihydroquinoline-3-carboxamide?
N-oxo-1,2-dihydroquinoline-3-carboxamide has a molecular weight of 188.19 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-oxo-1,2-dihydroquinoline-3-carboxamide is sourced from PubChem (CID 88532555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).