C8H12F7N — CID 88532701
N-(1,1,2,2,3,3,3-heptafluoropropyl)pentan-1-amine (PubChem CID 88532701) has the molecular formula C8H12F7N and a molecular weight of 255.18 g/mol. Its IUPAC name is N-(1,1,2,2,3,3,3-heptafluoropropyl)pentan-1-amine.
| Compound Name | N-(1,1,2,2,3,3,3-heptafluoropropyl)pentan-1-amine |
|---|---|
| PubChem CID | 88532701 |
| Molecular Formula | C8H12F7N |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-(1,1,2,2,3,3,3-heptafluoropropyl)pentan-1-amine |
| SMILES | CCCCCNC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F7N/c1-2-3-4-5-16-8(14,15)6(9,10)7(11,12)13/h16H,2-5H2,1H3 |
| InChIKey | GVBYDVIJDZWCRH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|