About (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine
(3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine (PubChem CID 88533386) has the molecular formula C11H23NS
and a molecular weight of 201.38 g/mol. Its IUPAC name is (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine.
Molecular Properties
| Compound Name | (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine |
| PubChem CID | 88533386 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine |
| SMILES | C=C([C@@H](N)CCSC)C(C)(C)CC |
| InChI | InChI=1S/C11H23NS/c1-6-11(3,4)9(2)10(12)7-8-13-5/h10H,2,6-8,12H2,1,3-5H3/t10-/m0/s1 |
| InChIKey | ZTESZJSOHXZHKP-JTQLQIEISA-N |
| XLogP | 3.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine?
The IUPAC name of (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine (CID 88533386) is (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine.
What is the SMILES notation for (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine?
The canonical SMILES for (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine is C=C([C@@H](N)CCSC)C(C)(C)CC.
What is the InChIKey of (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine?
The InChIKey is ZTESZJSOHXZHKP-JTQLQIEISA-N. The full InChI is InChI=1S/C11H23NS/c1-6-11(3,4)9(2)10(12)7-8-13-5/h10H,2,6-8,12H2,1,3-5H3/t10-/m0/s1.
What are the key properties of (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine?
(3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine has a molecular weight of 201.38 g/mol, XLogP of 3.06, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5,5-dimethyl-4-methylidene-1-methylsulfanylheptan-3-amine is sourced from PubChem (CID 88533386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).