C45H54N2O3S2 — CID 88533449
10-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-7-hexyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde (PubChem CID 88533449) has the molecular formula C45H54N2O3S2 and a molecular weight of 735.07 g/mol. Its IUPAC name is 10-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-7-hexyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde.
| Compound Name | 10-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-7-hexyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde |
|---|---|
| PubChem CID | 88533449 |
| Molecular Formula | C45H54N2O3S2 |
| Molecular Weight | 735.07 g/mol |
| Exact Mass | 734.36 |
| IUPAC Name | 10-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-7-hexyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-4-carbaldehyde |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3cc4c(s3)c3sc(C=O)cc3n4CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C45H54N2O3S2/c1-4-7-10-13-28-46-41-31-40(33-48)51-44(41)45-42(46)32-43(52-45)34-16-18-35(19-17-34)47(36-20-24-38(25-21-36)49-29-14-11-8-5-2)37-22-26-39(27-23-37)50-30-15-12-9-6-3/h16-27,31-33H,4-15,28-30H2,1-3H3 |
| InChIKey | OMDVFLRNOWQPHY-UHFFFAOYSA-N |
| XLogP | 14.37 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.07 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|